Butylated hydroxyanisole
Butylhydroxyanisole is an antioxidant, consisting of a mixture of two isomeric organic compounds, used as a food additive preservative
| Trivial name | Butylated Hydroxyanisole; BHA; E320 |
| Catalog Number | CSN10519 |
| Alternative Name(s) | Butylated Hydroxyanisole; BHA; E320 |
| Research Area | / |
| Molecular Formula | C22H32O4 |
| CAS# | 25013-16-5 |
| Purity | ≥99% |
| SMILES | OC1=CC=C(OC)C=C1C(C)(C)C.OC2=CC=C(OC)C(C(C)(C)C)=C2 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/butylated-hydroxyanisole.html |