Aloesin
Aloesin (Aloeresin) is an active constituent of the herb aloe vera and displays anti-inflammatory activity, ultraviolet protection, and antibacterium effects. Aloesin exerts its anticancer effect through the MAPK signaling pathway[1][2].
| Trivial name | / |
| Catalog Number | CSN23314 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C19H22O9 |
| CAS# | 30861-27-9 |
| Purity | ≥99% |
| SMILES | O=C1C=C(CC(C)=O)OC2=C1C(C)=CC(O)=C2[C@H]3[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O3 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/aloesin.html |