Forsythoside B
Forsythoside B is a natural product isolated and purified from the fruits of Forsythia suspensa which inhibits inflammatory response,and has antioxidant properties with potent neuroprotective effects with a favorable therapeutic time-window, reduce of cerebral ischemia and reperfusion injury degree, attenuating blood-brain barrier (BBB) breakdown, and can rescue cardiac function from I/R injury.
| Trivial name | Forsythoside-B |
| Catalog Number | CSN16027 |
| Alternative Name(s) | Forsythoside-B |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C34H44O19 |
| CAS# | 81525-13-5 |
| Purity | ≥99% |
| SMILES | OC1=C(O)C=C(/C=C/C(O[C@H]2[C@H](O[C@]3([H])O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](OCCC4=CC=C(O)C(O)=C4)O[C@@H]2CO[C@H]5[C@H](O)[C@](CO)(O)CO5)=O)C=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/forsythoside-b.html |