2-Chloroadenosine
2-Chloroadenosine, a stable adenosine analogue, protects against long term development of ischaemic cell loss in the rat hippocampus. 2-Chloroadenosine is an apparent competitive inhibitor of uridine influx (apparent Ki=33 μM) and high-affinity nitrobenzylthioinosine binding (apparent Ki=0.18 mM). 2-Chloroadenosine is a transported permeant for the nucleoside transporter in human erythrocytes[1][2].
| Trivial name | / |
| Catalog Number | CSN25359 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C10H12ClN5O4 |
| CAS# | 146-77-0 |
| Purity | ≥99% |
| SMILES | OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=C(Cl)N=C3N)O1)O)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/2-chloroadenosine.html |