α-Terpineol
α-Terpineol, a natural monoterpene, is the major component of essential oils of several species of aromatic plants such as Origanium vulgare L. and Ocimum canum Sims which are widely used for medicinal purposes. It is widely used in the manufacturing of cosmetics, soaps, perfumes, antiseptic agents and is considered one of the most frequently used fragrance compounds.
| Trivial name | (S)-α-Terpineol |
| Catalog Number | CSN24906 |
| Alternative Name(s) | (S)-α-Terpineol |
| Research Area | / |
| Molecular Formula | C10H18O |
| CAS# | 10482-56-1 |
| Purity | ≥99% |
| SMILES | CC(O)([C@@H]1CC=C(C)CC1)C |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/a-terpineol.html |