Deferoxamine Mesylate
Deferoxamine mesylate as a chelating agent used to remove excess iron from the body, treat acute iron poisoning, especially in small children, used to treat hemochromatosis, that can be either genetic or acquired.
Trivial name | Desferrioxamine B Mesylate; DFOM |
Catalog Number | CSN12565 |
Alternative Name(s) | Desferrioxamine B Mesylate; DFOM |
Research Area | / |
Molecular Formula | C26H52N6O11S |
CAS# | 138-14-7 |
Purity | ≥99% |
SMILES | O=C(N(CCCCCN)O)CCC(NCCCCCN(O)C(CCC(NCCCCCN(O)C(C)=O)=O)=O)=O.CS(=O)(O)=O |
Size | 25mg |
Supplier Page | https://www.csnpharm.com/products/deferoxamine-mesylate.html |