Brequinar
Brequinar (DUP785) is a potent inhibitor of dihydroorotate dehydrogenase (DHODH) with an IC50 of 5.2 nM for human DHODH. Brequinar has potent activities against a broad spectrum of viruses.
| Trivial name | DUP785; NSC 368390 |
| Catalog Number | CSN25384 |
| Alternative Name(s) | DUP785; NSC 368390 |
| Research Area | Infection |
| Molecular Formula | C23H15F2NO2 |
| CAS# | 96187-53-0 |
| Purity | ≥99% |
| SMILES | O=C(C1=C(C)C(C2=CC=C(C3=CC=CC=C3F)C=C2)=NC4=CC=C(F)C=C14)O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/6-fluoro-2-(2'-fluoro-[1,1'-biphenyl]-4-yl)-3-methylquinoline-4-carboxylic-acid.html |