Quercetin-7-O-β-D-glucopyranoside
Quercetin-7-O-beta-D-glucopyranoside, a natural product isolated and purified from the herbs of Rostellularia procumbens with antibacterial, antioxidative and anti-inflammatory activities, inhibits overexpression of cyclooxygenase-2 and granulocyte macrophage-colony-stimulating factor.
| Trivial name | Quercetin-7-O-beta-D-glucopyranoside |
| Catalog Number | CSN19924 |
| Alternative Name(s) | Quercetin-7-O-beta-D-glucopyranoside |
| Research Area | / |
| Molecular Formula | C21H20O12 |
| CAS# | 491-50-9 |
| Purity | ≥98% |
| SMILES | O=C1C(O)=C(C2=CC=C(O)C(O)=C2)OC3=C1C(O)=CC(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O4)=C3 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/quercetin-7-o-b-d-glucopyranoside.html |