Pyrantel Tartrate
Pyrantel tartrate is an antinematodal thiophene and a nicotinic receptor agonist and can elicit spastic muscle paralysis in parasitic worms due to prolonged activation of the excitatory nicotinic acetylcholine (nACh) receptors on body wall muscle.
Trivial name | Pyrantel(+)-tartrate Salt |
Catalog Number | CSN11804 |
Alternative Name(s) | Pyrantel(+)-tartrate Salt |
Research Area | Infection |
Molecular Formula | C₁₅H₂₀N₂O₆S |
CAS# | 33401-94-4 |
Purity | ≥98% |
SMILES | CN1CCCN=C1/C=C/C2=CC=CS2.O=C(O)[C@H](O)[C@@H](O)C(O)=O |
Size | 100mg |
Supplier Page | https://www.csnpharm.com/products/pyrantel-tartrate.html |