Indinavir
Indinavir is a potent and specific HIV protease inhibitor that appears to have good oral bioavailability. Indinavir could inhibit SARS-CoV-2 3CLpro main protease.
| Trivial name | MK-639; L 735524 |
| Catalog Number | CSN11198 |
| Alternative Name(s) | MK-639; L 735524 |
| Research Area | Infection |
| Molecular Formula | C36H47N5O4 |
| CAS# | 150378-17-9 |
| Purity | ≥98% |
| SMILES | O=C([C@@H](C[C@H](O)CN(CCN(CC1=CN=CC=C1)C2)[C@@H]2C(NC(C)(C)C)=O)CC3=CC=CC=C3)N[C@H]4C(C=CC=C5)=C5C[C@H]4O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/indinavir.html |