Eflornithine HCl
Eflornithine HCl is a drug found to be effective in the treatment of facial hirsutism.
| Trivial name | DFMO HCl; MDL-71782 HCl; RMI-71782 HCl; α-difluoromethylornithine HCl |
| Catalog Number | CSN19511 |
| Alternative Name(s) | DFMO HCl; MDL-71782 HCl; RMI-71782 HCl; α-difluoromethylornithine HCl |
| Research Area | / |
| Molecular Formula | C6H13ClF2N2O2 |
| CAS# | 68278-23-9 |
| Purity | ≥98% |
| SMILES | O=C(O)C(C(F)F)(N)CCCN.[H]Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/eflornithine-hcl.html |