3′-O-Methylorobol
3′-O-Methylorobol, a natural product isolated and purified from the herbs of Kadsura interior, can increase osteoblast differentiation and exhibits moderate antioxidant activity in the 2,2-diphenyl-1-picrylhydrazyl free radical scavenging assay.
| Trivial name | / |
| Catalog Number | CSN14277 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C16H12O6 |
| CAS# | 36190-95-1 |
| Purity | ≥98% |
| SMILES | O=C1C(C2=CC=C(O)C(OC)=C2)=COC3=CC(O)=CC(O)=C13 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/3'-o-methylorobol.html |