NS-309
NS-309 is a positive modulator of small- and intermediate- conductance Ca2+-activated K+ channels (KCa2 and KCa3.1 channels). It increases Ca2+ sensitivity and displays no activity at BK channels.
| Trivial name | / |
| Catalog Number | CSN13720 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C8H4Cl2N2O2 |
| CAS# | 18711-16-5 |
| Purity | ≥98% |
| SMILES | O=C1NC2=C(C=CC(Cl)=C2Cl)/C1=N/O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/ns-309.html |