L-Arabinitol
L-Arabinitol is a potential biomarker for the comsuption of the food products such as sweet potato, deerberry, moth bean, and is also associated with Alzheimer’s disease and ribose-5-phosphate isomerase deficiency.
| Trivial name | L-(-)-Arabitol |
| Catalog Number | CSN23569 |
| Alternative Name(s) | L-(-)-Arabitol |
| Research Area | / |
| Molecular Formula | C5H12O5 |
| CAS# | 7643-75-6 |
| Purity | ≥98% |
| SMILES | OC[C@@H](C([C@H](CO)O)O)O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/l-arabinitol.html |