Caftaric Acid
Caftaric acid, a natural product isolated and purified from the herbs of Echinacea purpurea with anti-mutagenicity, is also an inhibitor of the protein-protein interactions mediated by the Src-family kinases.
| Trivial name | trans-Caftaric Acid |
| Catalog Number | CSN11627 |
| Alternative Name(s) | trans-Caftaric Acid |
| Research Area | / |
| Molecular Formula | C13H12O9 |
| CAS# | 67879-58-7 |
| Purity | ≥98% |
| SMILES | O=C(O)[C@H](OC(/C=C/C1=CC=C(O)C(O)=C1)=O)[C@@H](O)C(O)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/caftaric-acid.html |