TIC10 Isomer
TIC10 isomer is an isomer of TIC10, a potent, orally active, and stable small molecule that transcriptionally induces TRAIL in a p53-independent manner and crosses the blood-brain barrier.
| Trivial name | NSC 350625; ONC-201 Isomer |
| Catalog Number | CSN16545 |
| Alternative Name(s) | NSC 350625; ONC-201 Isomer |
| Research Area | Cancer |
| Molecular Formula | C24H26N4O |
| CAS# | 41276-02-2 |
| Purity | ≥98% |
| SMILES | O=C1C(CN(CC2=CC=CC=C2)CC3)=C3N(CC4=CC=CC=C4C)C5=NCCN15 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/tic10-isomer.html |