Isolariciresinol
Isolariciresinol, a natural product isolated and purified from the herbs of Phyllanthus niruri, has antioxidant and anti-inflammatory activities during an in vitro gastro-intestinal digestion of the Radix Isatidis extract (RIE).
| Trivial name | / |
| Catalog Number | CSN14061 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C20H24O6 |
| CAS# | 548-29-8 |
| Purity | ≥98% |
| SMILES | OC1=CC2=C(C=C1OC)C[C@@H](CO)[C@H](CO)[C@H]2C3=CC(OC)=C(O)C=C3 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/isolariciresinol.html |