Theobromine
Theobromine, a xanthine alkaloid isolated and purified from the fruits of Theobroma cacao L., is widely consumed as stimulants and snacks in coffee and cocoa based foods and most often as part of ingredients in drugs.
| Trivial name | 3,7-Dimethylxanthine |
| Catalog Number | CSN19348 |
| Alternative Name(s) | 3,7-Dimethylxanthine |
| Research Area | Cancer |
| Molecular Formula | C7H8N4O2 |
| CAS# | 83-67-0 |
| Purity | ≥98% |
| SMILES | O=C(N1)N(C)C2=C(N(C)C=N2)C1=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/theobromine.html |