SCH23390
Potent dopamine receptor antagonist (Ki values are 0.2 nM and 0.3 nM at D1 and D5 receptor sub-types, respectively). Also an agonist at 5-HT1C and 5-HT2C receptors in vitro (Ki values are 6.3 nM and 9.3 nM respectively). Blocks quinpirole-induced Kir3 (GIRK) currents (EC50 = 268 nM) independently of receptors.
| Trivial name | / |
| Catalog Number | CSN21076 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C21H22ClNO5 |
| CAS# | 87134-87-0 |
| Purity | ≥98% |
| SMILES | OC1=C(Cl)C=C2CCN(C)C[C@H](C3=CC=CC=C3)C2=C1.O=C(O)/C=C/C(O)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/sch23390.html |