Cetraxate
Cetraxate is an oral gastrointestinal medication which has a cytoprotective effect. Double-blind clinical trials in patients with gastric ulcer compared the effects of cetraxate with those of the drug gefarnate, a common standard drug treatment for gastric ulcer.
| Trivial name | / |
| Catalog Number | CSN10601 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C17H23NO4 |
| CAS# | 34675-84-8 |
| Purity | ≥98% |
| SMILES | O=C(O)CCC1=CC=C(OC([C@H]2CC[C@H](CN)CC2)=O)C=C1 |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/cetraxate.html |