SL0101
SL0101 is a selective inhibitor of ribosomal S6 kinase (RSK) (IC50 = 89 nM for RSK2) which does not inhibit upstream kinases such as MEK, Raf and PKC. SL0101 Inhibits the growth of MCF-7 human breast cancer cells with no effect on the normal breast cell line.
| Trivial name | SL 0101-1 |
| Catalog Number | CSN20281 |
| Alternative Name(s) | SL 0101-1 |
| Research Area | Cancer |
| Molecular Formula | C25H24O12 |
| CAS# | 77307-50-7 |
| Purity | ≥98% |
| SMILES | C[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](O)[C@H](OC2=C(C3=CC=C(O)C=C3)OC4=C(C(O)=CC(O)=C4)C2=O)O1 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/sl0101.html |