Leachianone A
Leachianone A, a natural product isolated and purified from the roots of Sophora flavescens, possesses a profound cytotoxic activity against human hepatoma cell line HepG2 in vitro, with an IC(50) value of 3.4mg/mL post-48-h treatment.
| Trivial name | Leachianone-A |
| Catalog Number | CSN13661 |
| Alternative Name(s) | Leachianone-A |
| Research Area | Cancer |
| Molecular Formula | C26H30O6 |
| CAS# | 97938-31-3 |
| Purity | ≥98% |
| SMILES | O=C1C[C@@H](C2=CC=C(O)C=C2OC)OC3=C1C(O)=CC(O)=C3C[C@H](C(C)=C)C/C=C(C)\C |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/leachianone-a.html |