Dihydro-β-erythroidine hydrobromide
Dihydro-β-erythroidine hydrobromide is a nicotinic acetylcholine receptor antagonist of neuronal α4 receptor subunit, the IC50 values against α4β4 and α4β2 receptors are 0.19 and 0.37 μM, espectively.
| Trivial name | / |
| Catalog Number | CSN24518 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C16H22BrNO3 |
| CAS# | 29734-68-7 |
| Purity | ≥98% |
| SMILES | O=C1CC2=C(CO1)CCN3CCC4=CC[C@H](OC)C[C@]342.[H]Br |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/dihydro-b-erythroidine-hydrobromide.html |