GI 530159
CCI-006 is a novel inhibitor of mll-rearranged and calm-af10 translocated leukemias, inhibiting mitochondrial respiration and inducing mitochondrial membrane depolarization and apoptosis in a subset (7/11, 64%) of mll-rearranged leukemia cell lines within a few hours of treatment
| Trivial name | / |
| Catalog Number | CSN24317 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C27H20F6N2O2 |
| CAS# | 69563-88-8 |
| Purity | ≥98% |
| SMILES | NC1=CC=C(OC2=CC=C(C(C(F)(F)F)(C3=CC=C(OC4=CC=C(N)C=C4)C=C3)C(F)(F)F)C=C2)C=C1 |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/gi-530159.html |