(E)-3PO
(E)-3PO is a small-molecule inhibitor of the PFKFB3 isozyme, 3PO markedly attenuates the proliferation of several human malignant hematopoietic and adenocarcinoma cell lines (IC50, 1.4-24 μM) which target: PFKFB3 isozyme. 3PO inhibits recombinant PFKFB3 activity, suppresses glucose uptake, and decreases the intracellular concentration of Fru-2,6-BP, lactate, ATP, NAD+, and NADH in vitro.
| Trivial name | (E)-3-PO |
| Catalog Number | CSN13880 |
| Alternative Name(s) | (E)-3-PO |
| Research Area | Cancer |
| Molecular Formula | C13H10N2O |
| CAS# | 18550-98-6 |
| Purity | ≥98% |
| SMILES | O=C(C1=CC=NC=C1)/C=C/C2=CC=CN=C2 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/(e)-3po.html |