Kaempferol 3,7,4′-Trimethylether
Kaempferol 3,7,4′-trimethylether is a natural product isolated and purified from the rhizomes of Curcuma aromatica, shows selective cyctoxic activities against the nine tested cancer cell lines.
| Trivial name | Kaempferol 3,7,4'-Trimethyl Ether |
| Catalog Number | CSN11243 |
| Alternative Name(s) | Kaempferol 3,7,4'-Trimethyl Ether |
| Research Area | / |
| Molecular Formula | C18H16O6 |
| CAS# | 15486-34-7 |
| Purity | ≥98% |
| SMILES | O=C1C(OC)=C(C2=CC=C(OC)C=C2)OC3=CC(OC)=CC(O)=C13 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/kaempferol-3,7,4'-trimethylether.html |