Fidarestat
Fidarestat is an inhibitor of aldose reductase, with IC50s of 26 nM, 33 μM, and 1.8 μM for aldose reductase, AKR1B10 and V301L AKR1B10, respectively; Fidarestat has the potential to treat diabetic disease.
| Trivial name | SK 860 |
| Catalog Number | CSN22130 |
| Alternative Name(s) | SK 860 |
| Research Area | Metabolic Disease |
| Molecular Formula | C12H10FN3O4 |
| CAS# | 136087-85-9 |
| Purity | ≥98% |
| SMILES | CC1([C@H](C(C)=C[C@@H](C1)O)/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(C[C@H](CC2(C)C)O)C)C)C)C |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/fidarestat.html |