Eupatoriochromene
Eupatoriochromene, a natural product isolated and purified from the herbs of Centaurea solstitialis L., retards seed germination and reduces radicle and hypocotyl growth of weed and crop plant seedlings and increased adventitious root formation of mung bean cuttings.
| Trivial name | / |
| Catalog Number | CSN14062 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C13H14O3 |
| CAS# | 19013-03-7 |
| Purity | ≥98% |
| SMILES | CC(C1=C(O)C=C2C(C=CC(C)(C)O2)=C1)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/eupatoriochromene.html |