Cerevisterol
Cerevisterol, a natural cytotoxic steroid isolated and purified from the fruit body of Ganoderma lucidum, can inhibit the activity of DNA polymerase alpha and stimulate NGF-mediated neurite outgrowth on PC12 cells.
| Trivial name | / |
| Catalog Number | CSN14077 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C28H46O3 |
| CAS# | 516-37-0 |
| Purity | ≥98% |
| SMILES | C[C@H](C(C)C)/C=C/[C@@H](C)[C@H]1CC[C@@]2([H])C3=C[C@@H](O)[C@@]4(O)C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/cerevisterol.html |