Luteollin 5-Glucoside
Luteollin 5-glucoside is a natural product isolated and purified from the herb of Dracocephalum ruyschiana L. with antioxidant activity, which can inhibit lipid peroxidation, and has DPPH radical-scavenging activity.
| Trivial name | Luteolin-5-O-B-D-Glucopyranoside |
| Catalog Number | CSN13541 |
| Alternative Name(s) | Luteolin-5-O-B-D-Glucopyranoside |
| Research Area | / |
| Molecular Formula | C21H20O11 |
| CAS# | 20344-46-1 |
| Purity | ≥98% |
| SMILES | O=C1C=C(C2=CC=C(O)C(O)=C2)OC3=C1C(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O4)=CC(O)=C3 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/luteollin-5-glucoside.html |