Chelidonine
Chelidonine, a natural product isolated and purified from the herbs of Chelidonium majus L., efficiently induced apoptosis in HeLa cells through possible alteration of p38-p53 and AKT/PI3 kinase signalling pathways.
| Trivial name | / |
| Catalog Number | CSN10608 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C20H19NO5 |
| CAS# | 476-32-4 |
| Purity | ≥98% |
| SMILES | O[C@H]1CC(C([C@@]2([H])N(C)CC3=C([C@]21[H])C=CC4=C3OCO4)=C5)=CC6=C5OCO6 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/chelidonine.html |