Gossypol
Gossypol has been known to exert a potential for anti-cancer, anti-inflammatory and other important therapeutic activities, gossypol binds and antagonizes anti-apoptotic effect of Bcl-2 family proteins
| Trivial name | BL-193; Pogosin |
| Catalog Number | CSN12617 |
| Alternative Name(s) | BL-193; Pogosin |
| Research Area | Cancer |
| Molecular Formula | C30H30O8 |
| CAS# | 303-45-7 |
| Purity | ≥98% |
| SMILES | O=CC1=C(O)C(O)=C(C(C)C)C2=CC(C)=C(C3=C(C)C=C4C(C(C)C)=C(O)C(O)=C(C=O)C4=C3O)C(O)=C12 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/gossypol.html |