Linarin
Linarin, a natural product isolated and purified from the herb of Uncaria sinensis (Oliv.) Havil., prevents a beta-induced neurotoxicity through the activation of PI3K/Akt, which subsequently inhibits GSK-3b and up-regulates Bcl-2.
| Trivial name | / |
| Catalog Number | CSN11302 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C28H32O14 |
| CAS# | 480-36-4 |
| Purity | ≥98% |
| SMILES | O=C1C=C(C2=CC=C(OC)C=C2)OC3=CC(O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]5[C@@H]([C@@H]([C@H]([C@H](C)O5)O)O)O)O4)O)O)O)=CC(O)=C13 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/linarin.html |