Procyanidin B2
Procyanidin B2 exerts a potent and beneficial role in reducing granulosa cell apoptosis and inducing autophagy process,and exerts a variety of potent protective pharmacological effects on diabetic complications.
| Trivial name | Procyanidin-B2 |
| Catalog Number | CSN11779 |
| Alternative Name(s) | Procyanidin-B2 |
| Research Area | Metabolic Disease |
| Molecular Formula | C30H26O12 |
| CAS# | 29106-49-8 |
| Purity | ≥98% |
| SMILES | O[C@H]1[C@@H](C2=CC=C(O)C(O)=C2)OC3=C(C(O)=CC(O)=C3)[C@@H]1C4=C(O)C=C(O)C5=C4O[C@H](C6=CC=C(O)C(O)=C6)[C@H](O)C5 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/procyanidin-b2.html |