Dichlorphenamide
Dichlorphenamide is a sulfonamide and an orally bioavailable carbonic anhydrase (CA) inhibitor with Kis of 1.20, 38, 50, and 50 nM for the human CA isoforms CAI, CAII, CAIX, and CAXII, respectively.
| Trivial name | Diclofenamide; 4,5-Dichloro-1,3-benzenedisulfonamide |
| Catalog Number | CSN10791 |
| Alternative Name(s) | Diclofenamide; 4,5-Dichloro-1,3-benzenedisulfonamide |
| Research Area | / |
| Molecular Formula | C6H6Cl2N2O4S2 |
| CAS# | 120-97-8 |
| Purity | ≥98% |
| SMILES | O=S(C1=C(Cl)C(Cl)=CC(S(=O)(N)=O)=C1)(N)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/dichlorphenamide.html |