SLV 320
SLV320 is an orally active, high-affinity adenosine receptor A1 antagonist, with Ki values of 1, 200, 398 and 3981 nM at human A1, A3, A2A and A2B receptors, respectively.
| Trivial name | / |
| Catalog Number | CSN23120 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C18H20N4O |
| CAS# | 251945-92-3 |
| Purity | ≥98% |
| SMILES | O[C@H]1CC[C@H](NC2=C3C(NC=C3)=NC(C4=CC=CC=C4)=N2)CC1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/slv-320.html |