Telaprevir
Telaprevir is a potent, selective, peptidomimetic inhibitor of the hepatitis C virus (HCV) NS3-4A serine protease (Ki=7 nM, genotype 1a NS3-4A protease).
| Trivial name | LY-570310; MP 424; VX 950 |
| Catalog Number | CSN12417 |
| Alternative Name(s) | LY-570310; MP 424; VX 950 |
| Research Area | Infection |
| Molecular Formula | C36H53N7O6 |
| CAS# | 402957-28-2 |
| Purity | ≥98% |
| SMILES | O=C(N([C@@H]1C(N[C@H](C(C(NC2CC2)=O)=O)CCC)=O)C[C@@]3(CCC[C@@]31[H])[H])[C@@H](NC([C@@H](NC(C4=NC=CN=C4)=O)C5CCCCC5)=O)C(C)(C)C |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/telaprevir.html |