Furomollugin
Furomollugin is a natural product isolated and purified from the roots of Rubia cordifolia L. with antiviral activity, can strongly suppress the secretion of hepatitis B surface antigen (HBsAg), with IC50 of 2.0 mg/mL, in human hepatoma Hep3B cells.
| Trivial name | / |
| Catalog Number | CSN14395 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C14H10O4 |
| CAS# | 61658-41-1 |
| Purity | ≥98% |
| SMILES | O=C(C1=C2C(OC=C2)=C3C=CC=CC3=C1O)OC |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/furomollugin.html |