F16
F16 is a small molecule that selectively inhibits proliferation of mammary epithelial, neu-overexpressing cells, as well as a variety of mouse mammary tumor and human breast cancer cell lines.
| Trivial name | / |
| Catalog Number | CSN18239 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C16H15IN2 |
| CAS# | 36098-33-6 |
| Purity | ≥98% |
| SMILES | C[N+]1=CC=C(/C=C/C2=CNC3=C2C=CC=C3)C=C1.[I-] |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/f16.html |