Tabersonine
Tabersonine, a natural product isolated and purified from the root bark of Voacanga africana Stapf, is a precursor for vincristine used in cancer chemotherapy, the biocompatibility and small size essential for permeating the blood-brain barrier make it a potential therapeutic drug candidate for treating AD.
| Trivial name | / |
| Catalog Number | CSN12022 |
| Alternative Name(s) | / |
| Research Area | Cancer|Neurological Disease |
| Molecular Formula | C21H24N2O2 |
| CAS# | 4429-63-4 |
| Purity | ≥98% |
| SMILES | CC[C@]12[C@]3([C@@]4(C(NC5=C4C=CC=C5)=C(C2)C(OC)=O)CCN3CC=C1)[H] |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/tabersonine.html |