APTO-253
APTO-253 is a small molecule with potent anti-tumor activity in cancer cells via induction of the gene that expresses the Kruppel-like factor 4 (KLF4) master transcription factor, leading to cell cycle inhibition and programmed cell death.
| Trivial name | LOR-253; LT 253 |
| Catalog Number | CSN18571 |
| Alternative Name(s) | LOR-253; LT 253 |
| Research Area | Cancer |
| Molecular Formula | C22H14FN5 |
| CAS# | 916151-99-0 |
| Purity | ≥98% |
| SMILES | CC(N1)=C(C(N2)=NC3=C2C4=CC=CN=C4C5=NC=CC=C53)C6=C1C=CC(F)=C6 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/apto-253.html |