Artemetin
Artemetin, a natural product isolated and purified from the herbs of Achillea millefolium L., protects endothelial function by acting as antioxidant and antiapoptotic agent and through the activation of ERK1/2 and Akt.
| Trivial name | / |
| Catalog Number | CSN13984 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C20H20O8 |
| CAS# | 479-90-3 |
| Purity | ≥98% |
| SMILES | O=C1C(OC)=C(C2=CC=C(OC)C(OC)=C2)OC3=CC(OC)=C(OC)C(O)=C13 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/artemetin.html |