Tubastatin A HCl
Tubastatin A HCl is a potent and selective HDAC6 inhibitor with IC50 of 15 nM and is selective(1000-fold more) against all other isozymes except HDAC8(57-fold more).
| Trivial name | TSA HCl |
| Catalog Number | CSN13649 |
| Alternative Name(s) | TSA HCl |
| Research Area | Cancer |
| Molecular Formula | C20H22ClN3O2 |
| CAS# | 1310693-92-5 |
| Purity | ≥98% |
| SMILES | O=C(NO)C1=CC=C(CN2C3=C(CN(C)CC3)C4=C2C=CC=C4)C=C1.[H]Cl |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/tubastatin-a-hcl.html |