Imiquimod HCl
Imiquimod HCl is an immune response modifier that acts as a toll-like receptor 7 agonist and is commonly used topically to treat warts on the skin of the genital and anal areas.
| Trivial name | R 837 HCl |
| Catalog Number | CSN18646 |
| Alternative Name(s) | R 837 HCl |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C14H17ClN4 |
| CAS# | 99011-78-6 |
| Purity | ≥98% |
| SMILES | NC1=NC2=CC=CC=C2C3=C1N=CN3CC(C)C.Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/imiquimod-hcl.html |