Ellipticine
Ellipticine is a potent antineoplastic agent exhibiting multiple mechanisms of action, IC50 of 1.25±0.13, 0.67±0.06, 1.25±0.13, 0.67±0.06, 0.27±0.02, 0.44±0.03, 0.49±0.04, and 1.48±0.62 μM for Breast adenocarcinoma MCF-7, Leukemia HL-60, Breast adenocarcinoma MCF-7, Leukemia HL-60, Neuroblastoma IMR-32, Neuroblastoma UKF-NB-3, Neuroblastoma UKF-NB-4, and Glioblastoma U87MG cell, respectively.
| Trivial name | / |
| Catalog Number | CSN12399 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C17H14N2 |
| CAS# | 519-23-3 |
| Purity | ≥98% |
| SMILES | CC1=C(C=NC=C2)C2=C(C)C(N3)=C1C4=C3C=CC=C4 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/ellipticine.html |