LY354740
LY354740 is a highly potent, efficacious and selective group II (mGlu2/3) receptor agonist, produces > 90% suppression of forskolin-stimulated cAMP formation with an EC50 of 5.1 ± 0.3 nM.
| Trivial name | Eglumegad |
| Catalog Number | CSN18024 |
| Alternative Name(s) | Eglumegad |
| Research Area | Neurological Disease |
| Molecular Formula | C8H11NO4 |
| CAS# | 176199-48-7 |
| Purity | ≥98% |
| SMILES | OC([C@]1([C@]2([H])[C@@H](C(O)=O)[C@]2([H])CC1)N)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/ly354740.html |