Bisdemethoxycucurmin
Bisdemethoxycurcumin is a natural demethoxy derivative isolated and purified from curcumin. Bisdemethoxycurcumin suppresses proliferation in cancer cells. It down-regulates the transcriptional coactivator p300, suppressing the Wnt/β-catenin pathway, and inhibits LPS induction of iNOS expression.
| Trivial name | BDMC |
| Catalog Number | CSN15673 |
| Alternative Name(s) | BDMC |
| Research Area | Cancer |
| Molecular Formula | C19H16O4 |
| CAS# | 24939-16-0 |
| Purity | ≥98% |
| SMILES | O=C(CC(/C=C/C1=CC=C(O)C=C1)=O)/C=C/C2=CC=C(O)C=C2 |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/bisdemethoxycucurmin.html |