Idarubicin HCl
Idarubicin HCl is a HCl salt form of idarubicin which is an anthracycline antibiotic and a DNA topoisomerase II (topo II) inhibitor for MCF-7 cells with IC50 of 3.3 ng/mL in a cell-free assay.
| Trivial name | NSC256439 HCl; 4-DMDR HCl; 4-Demethoxydaunorubicin HCl |
| Catalog Number | CSN16766 |
| Alternative Name(s) | NSC256439 HCl; 4-DMDR HCl; 4-Demethoxydaunorubicin HCl |
| Research Area | Cancer |
| Molecular Formula | C26H28ClNO9 |
| CAS# | 57852-57-0 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(O)C([C@@H](O[C@H]3C[C@H](N)[C@H](O)[C@H](C)O3)C[C@](O)(C(C)=O)C4)=C4C(O)=C2C(C5=C1C=CC=C5)=O.[H]Cl |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/idarubicin-hcl.html |