β-Elemene
β-Elemene is a natural sesquiterpene found in various plants and imparts floral aromas to some plants. This compound has been reported to inhibit the proliferation of a wide range of tumors.
| Trivial name | (-)-β-Elemene; (-)-beta-Elemene; levo-β-Elemene |
| Catalog Number | CSN20351 |
| Alternative Name(s) | (-)-β-Elemene; (-)-beta-Elemene; levo-β-Elemene |
| Research Area | Cancer |
| Molecular Formula | C15H24 |
| CAS# | 515-13-9 |
| Purity | ≥98% |
| SMILES | C=C[C@@]1(C)[C@H](C(C)=C)C[C@H](C(C)=C)CC1 |
| Size | 2mg |
| Supplier Page | https://www.csnpharm.com/products/b-elemene.html |