Isoastilbin
Isoastilbin is a dihydroflavonol glycoside compound in Rhizoma Smilacis glabrae and Astragalus membranaceus. Isoastilbin inhibits glucosyltransferase (GTase) with an IC50 value of 54.3 μg/mL, and also inhibits tyrosinase activity. Isoastilbin shows neuroprotective, antioxidation, antimicrobial and anti-apoptotic properties and has the potential for Alzheimer’s disease research.
| Trivial name | / |
| Catalog Number | CSN27575 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C21H22O11 |
| CAS# | 54081-48-0 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(O)C=C(C=C2O[C@@H]([C@H]1O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)C4=CC=C(O)C(O)=C4)O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/isoastilbin.html |